C19H22N4O3 — CID 91762696
N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 91762696) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91762696 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(3S,4R)-3-(4-cyanophenoxy)oxan-4-yl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1cc(C(=O)N[C@@H]2CCOC[C@H]2Oc2ccc(C#N)cc2)cn1 |
| InChI | InChI=1S/C19H22N4O3/c1-13(2)23-11-15(10-21-23)19(24)22-17-7-8-25-12-18(17)26-16-5-3-14(9-20)4-6-16/h3-6,10-11,13,17-18H,7-8,12H2,1-2H3,(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | NRPAGPPFHYTBEZ-QZTJIDSGSA-N |
| XLogP | 2.30 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |