C13H19N3O4 — CID 156585287
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 156585287) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 156585287 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1cc(C(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cn1 |
| InChI | InChI=1S/C13H19N3O4/c1-7(2)16-4-8(3-14-16)13(18)15-9-5-19-12-10(17)6-20-11(9)12/h3-4,7,9-12,17H,5-6H2,1-2H3,(H,15,18)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | CMVKOHAYAHKMKJ-IRCOFANPSA-N |
| XLogP | -0.28 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |