C15H17NO7 — CID 156585419
methyl 3-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]-5-hydroxybenzoate (PubChem CID 156585419) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is methyl 3-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]-5-hydroxybenzoate.
| Compound Name | methyl 3-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]-5-hydroxybenzoate |
|---|---|
| PubChem CID | 156585419 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 3-[[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]-5-hydroxybenzoate |
| SMILES | COC(=O)c1cc(O)cc(C(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)c1 |
| InChI | InChI=1S/C15H17NO7/c1-21-15(20)8-2-7(3-9(17)4-8)14(19)16-10-5-22-13-11(18)6-23-12(10)13/h2-4,10-13,17-18H,5-6H2,1H3,(H,16,19)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | ZCKFTPGGPVOTQV-UMSGYPCISA-N |
| XLogP | -0.56 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |