C15H19NO5 — CID 155914260
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-ethoxybenzamide (PubChem CID 155914260) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-ethoxybenzamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 155914260 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)c1 |
| InChI | InChI=1S/C15H19NO5/c1-2-19-10-5-3-4-9(6-10)15(18)16-11-7-20-14-12(17)8-21-13(11)14/h3-6,11-14,17H,2,7-8H2,1H3,(H,16,18)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | FGHBBOXOFVHGTN-REWJHTLYSA-N |
| XLogP | 0.34 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |