C16H21NO6 — CID 156584374
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(4-ethoxyphenoxy)acetamide (PubChem CID 156584374) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(4-ethoxyphenoxy)acetamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(4-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 156584374 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-(4-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccc(OCC(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc1 |
| InChI | InChI=1S/C16H21NO6/c1-2-20-10-3-5-11(6-4-10)21-9-14(19)17-12-7-22-16-13(18)8-23-15(12)16/h3-6,12-13,15-16,18H,2,7-9H2,1H3,(H,17,19)/t12-,13+,15+,16+/m0/s1 |
| InChIKey | PPIDDZCPTZKTCJ-SJXGUFTOSA-N |
| XLogP | 0.11 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |