C15H19NO5 — CID 154565135
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenylmethoxyacetamide (PubChem CID 154565135) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenylmethoxyacetamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 154565135 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenylmethoxyacetamide |
| SMILES | O=C(COCc1ccccc1)N[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C15H19NO5/c17-12-8-21-14-11(7-20-15(12)14)16-13(18)9-19-6-10-4-2-1-3-5-10/h1-5,11-12,14-15,17H,6-9H2,(H,16,18)/t11-,12-,14-,15-/m1/s1 |
| InChIKey | FOQRKHZRMDPAPX-QHSBEEBCSA-N |
| XLogP | -0.15 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |