C19H22N2O4 — CID 91761107
2-phenylmethoxy-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide (PubChem CID 91761107) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-phenylmethoxy-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide.
| Compound Name | 2-phenylmethoxy-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91761107 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-phenylmethoxy-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide |
| SMILES | O=C(COCc1ccccc1)N[C@@H]1COCC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C19H22N2O4/c22-18(14-24-12-15-6-2-1-3-7-15)21-16-13-23-11-9-17(16)25-19-8-4-5-10-20-19/h1-8,10,16-17H,9,11-14H2,(H,21,22)/t16-,17-/m1/s1 |
| InChIKey | TZJHMIVGSSHJOW-IAGOWNOFSA-N |
| XLogP | 1.95 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |