C15H22N2O5S — CID 91766386
2-propan-2-ylsulfonyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide (PubChem CID 91766386) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-propan-2-ylsulfonyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide.
| Compound Name | 2-propan-2-ylsulfonyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91766386 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-propan-2-ylsulfonyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]acetamide |
| SMILES | CC(C)S(=O)(=O)CC(=O)N[C@@H]1COCC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C15H22N2O5S/c1-11(2)23(19,20)10-14(18)17-12-9-21-8-6-13(12)22-15-5-3-4-7-16-15/h3-5,7,11-13H,6,8-10H2,1-2H3,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | OSYYGJCUSHOGFD-CHWSQXEVSA-N |
| XLogP | 0.56 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |