C20H22N2O3 — CID 91795536
1-phenyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]cyclopropane-1-carboxamide (PubChem CID 91795536) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-phenyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-phenyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91795536 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-phenyl-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@H]1Oc1ccccn1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c23-19(20(10-11-20)15-6-2-1-3-7-15)22-16-14-24-13-9-17(16)25-18-8-4-5-12-21-18/h1-8,12,16-17H,9-11,13-14H2,(H,22,23)/t16-,17-/m1/s1 |
| InChIKey | XFNSNAFMOYAGBY-IAGOWNOFSA-N |
| XLogP | 2.47 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |