C14H16N4O3 — CID 91773229
N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]-1H-pyrazole-4-carboxamide (PubChem CID 91773229) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91773229 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1COCC[C@H]1Oc1ccccn1)c1cn[nH]c1 |
| InChI | InChI=1S/C14H16N4O3/c19-14(10-7-16-17-8-10)18-11-9-20-6-4-12(11)21-13-3-1-2-5-15-13/h1-3,5,7-8,11-12H,4,6,9H2,(H,16,17)(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | FIMLDOWBZSHPSN-VXGBXAGGSA-N |
| XLogP | 0.77 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |