C17H27N3O3 — CID 91777188
1,1-di(propan-2-yl)-3-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]urea (PubChem CID 91777188) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)-3-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]urea.
| Compound Name | 1,1-di(propan-2-yl)-3-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]urea |
|---|---|
| PubChem CID | 91777188 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1,1-di(propan-2-yl)-3-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]urea |
| SMILES | CC(C)N(C(=O)N[C@@H]1COCC[C@H]1Oc1ccccn1)C(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-12(2)20(13(3)4)17(21)19-14-11-22-10-8-15(14)23-16-7-5-6-9-18-16/h5-7,9,12-15H,8,10-11H2,1-4H3,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | PSLJFNXGMOLGIS-HUUCEWRRSA-N |
| XLogP | 2.45 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |