C14H21N3O5S — CID 91792493
3-(methanesulfonamido)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]propanamide (PubChem CID 91792493) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]propanamide.
| Compound Name | 3-(methanesulfonamido)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]propanamide |
|---|---|
| PubChem CID | 91792493 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-(methanesulfonamido)-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]propanamide |
| SMILES | CS(=O)(=O)NCCC(=O)N[C@@H]1COCC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C14H21N3O5S/c1-23(19,20)16-8-5-13(18)17-11-10-21-9-6-12(11)22-14-4-2-3-7-15-14/h2-4,7,11-12,16H,5-6,8-10H2,1H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | MIKPKGBQTDVEIH-VXGBXAGGSA-N |
| XLogP | -0.33 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |