C19H21N3O4 — CID 156608743
N-[2-oxo-2-[(4-pyridin-2-yloxyoxan-3-yl)amino]ethyl]benzamide (PubChem CID 156608743) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-oxo-2-[(4-pyridin-2-yloxyoxan-3-yl)amino]ethyl]benzamide.
| Compound Name | N-[2-oxo-2-[(4-pyridin-2-yloxyoxan-3-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 156608743 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[2-oxo-2-[(4-pyridin-2-yloxyoxan-3-yl)amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NC1COCCC1Oc1ccccn1 |
| InChI | InChI=1S/C19H21N3O4/c23-17(12-21-19(24)14-6-2-1-3-7-14)22-15-13-25-11-9-16(15)26-18-8-4-5-10-20-18/h1-8,10,15-16H,9,11-13H2,(H,21,24)(H,22,23) |
| InChIKey | MSYZHOIZFLECKA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |