C21H21NO6 — CID 26763421
2-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoic acid (PubChem CID 26763421) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 26763421 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO6/c23-20(14-8-4-5-9-15(14)21(24)25)22-16-11-27-19-17(12-28-18(16)19)26-10-13-6-2-1-3-7-13/h1-9,16-19H,10-12H2,(H,22,23)(H,24,25)/t16-,17+,18+,19+/m0/s1 |
| InChIKey | PHXCOJIKGRLQRU-WJFTUGDTSA-N |
| XLogP | 1.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |