C18H19NO5 — CID 162951488
N-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-2-carboxamide (PubChem CID 162951488) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-2-carboxamide.
| Compound Name | N-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 162951488 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@H]1OC[C@@H]2OCc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C18H19NO5/c20-18(14-7-4-8-21-14)19-13-10-23-17-15(11-24-16(13)17)22-9-12-5-2-1-3-6-12/h1-8,13,15-17H,9-11H2,(H,19,20)/t13-,15-,16-,17+/m0/s1 |
| InChIKey | PYTVZUXBQHCCRB-QSPRXWTASA-N |
| XLogP | 1.76 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |