C24H24N2O3S — CID 162804279
1-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylthiourea (PubChem CID 162804279) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 162804279 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[(3S,3aS,6S,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-naphthalen-1-ylthiourea |
| SMILES | S=C(Nc1cccc2ccccc12)N[C@H]1CO[C@H]2[C@H]1OC[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O3S/c30-24(25-19-12-6-10-17-9-4-5-11-18(17)19)26-20-14-28-23-21(15-29-22(20)23)27-13-16-7-2-1-3-8-16/h1-12,20-23H,13-15H2,(H2,25,26,30)/t20-,21-,22-,23+/m0/s1 |
| InChIKey | OXURQCZVDSKBSL-CWBXHPNXSA-N |
| XLogP | 3.88 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|