C28H25N3O4S — CID 73130975
[3-(naphthalen-1-ylcarbamothioylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate (PubChem CID 73130975) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is [3-(naphthalen-1-ylcarbamothioylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate.
| Compound Name | [3-(naphthalen-1-ylcarbamothioylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 73130975 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [3-(naphthalen-1-ylcarbamothioylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1cccc2ccccc12)OC1COC2C(NC(=S)Nc3cccc4ccccc34)COC12 |
| InChI | InChI=1S/C28H25N3O4S/c32-28(31-22-14-6-10-18-8-2-4-12-20(18)22)35-24-16-34-25-23(15-33-26(24)25)30-27(36)29-21-13-5-9-17-7-1-3-11-19(17)21/h1-14,23-26H,15-16H2,(H,31,32)(H2,29,30,36) |
| InChIKey | NFHLKUSTWQMMFP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|