C21H21N5O5 — CID 162805284
methyl 1-[(3S,3aS,6R,6aR)-3-(naphthalen-1-ylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate (PubChem CID 162805284) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is methyl 1-[(3S,3aS,6R,6aR)-3-(naphthalen-1-ylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3S,3aS,6R,6aR)-3-(naphthalen-1-ylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 162805284 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 1-[(3S,3aS,6R,6aR)-3-(naphthalen-1-ylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NC(=O)Nc2cccc3ccccc23)nn1 |
| InChI | InChI=1S/C21H21N5O5/c1-29-20(27)15-9-26(25-24-15)17-11-31-18-16(10-30-19(17)18)23-21(28)22-14-8-4-6-12-5-2-3-7-13(12)14/h2-9,16-19H,10-11H2,1H3,(H2,22,23,28)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | DIYDXEIETKPLGC-ZSYWTGECSA-N |
| XLogP | 1.75 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |