C18H22N4O5 — CID 11886687
N-[(3S,3aR,6S,6aR)-6-[4-(methoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenoxyacetamide (PubChem CID 11886687) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-[4-(methoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenoxyacetamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-[4-(methoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 11886687 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-[4-(methoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2-phenoxyacetamide |
| SMILES | COCc1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3NC(=O)COc2ccccc2)nn1 |
| InChI | InChI=1S/C18H22N4O5/c1-24-8-12-7-22(21-20-12)15-10-27-17-14(9-26-18(15)17)19-16(23)11-25-13-5-3-2-4-6-13/h2-7,14-15,17-18H,8-11H2,1H3,(H,19,23)/t14-,15-,17+,18+/m0/s1 |
| InChIKey | RQMCZMQSTJYFGK-CWLKWCNXSA-N |
| XLogP | 0.33 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |