C22H28N4O4 — CID 163174212
N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide (PubChem CID 163174212) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 163174212 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1cc(COc2ccccc2)nn1)C1CCCCC1 |
| InChI | InChI=1S/C22H28N4O4/c27-22(15-7-3-1-4-8-15)23-18-13-29-21-19(14-30-20(18)21)26-11-16(24-25-26)12-28-17-9-5-2-6-10-17/h2,5-6,9-11,15,18-21H,1,3-4,7-8,12-14H2,(H,23,27)/t18-,19+,20-,21+/m0/s1 |
| InChIKey | WPCZMAUUVHBVSW-JSXRDJHFSA-N |
| XLogP | 2.26 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |