C19H20N4O5S2 — CID 163180607
N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-sulfonamide (PubChem CID 163180607) has the molecular formula C19H20N4O5S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 163180607 |
| Molecular Formula | C19H20N4O5S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[(3S,3aS,6R,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CO[C@H]2[C@H]1OC[C@H]2n1cc(COc2ccccc2)nn1)c1cccs1 |
| InChI | InChI=1S/C19H20N4O5S2/c24-30(25,17-7-4-8-29-17)21-15-11-27-19-16(12-28-18(15)19)23-9-13(20-22-23)10-26-14-5-2-1-3-6-14/h1-9,15-16,18-19,21H,10-12H2/t15-,16+,18-,19+/m0/s1 |
| InChIKey | YYPVHPCFJSCTHO-OGWHTMIXSA-N |
| XLogP | 1.60 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |