C24H29N4O3+ — CID 11913290
[(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(3-phenylpropyl)azanium (PubChem CID 11913290) has the molecular formula C24H29N4O3+ and a molecular weight of 421.52 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(3-phenylpropyl)azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 11913290 |
| Molecular Formula | C24H29N4O3+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[4-(phenoxymethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-(3-phenylpropyl)azanium |
| SMILES | c1ccc(CCC[NH2+][C@H]2CO[C@H]3[C@@H]2OC[C@@H]3n2cc(COc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-3-8-18(9-4-1)10-7-13-25-21-16-30-24-22(17-31-23(21)24)28-14-19(26-27-28)15-29-20-11-5-2-6-12-20/h1-6,8-9,11-12,14,21-25H,7,10,13,15-17H2/p+1/t21-,22-,23+,24+/m0/s1 |
| InChIKey | YDXQDTPRKIMCJE-CJRSTVEYSA-O |
| XLogP | 1.76 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|