C19H26N6O2+2 — CID 11912085
[1-[(3S,3aR,6S,6aR)-3-[(3-cyanophenyl)methylazaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-dimethylazanium (PubChem CID 11912085) has the molecular formula C19H26N6O2+2 and a molecular weight of 370.46 g/mol. Its IUPAC name is [1-[(3S,3aR,6S,6aR)-3-[(3-cyanophenyl)methylazaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-dimethylazanium.
| Compound Name | [1-[(3S,3aR,6S,6aR)-3-[(3-cyanophenyl)methylazaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 11912085 |
| Molecular Formula | C19H26N6O2+2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [1-[(3S,3aR,6S,6aR)-3-[(3-cyanophenyl)methylazaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]triazol-4-yl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3[NH2+]Cc2cccc(C#N)c2)nn1 |
| InChI | InChI=1S/C19H24N6O2/c1-24(2)9-15-10-25(23-22-15)17-12-27-18-16(11-26-19(17)18)21-8-14-5-3-4-13(6-14)7-20/h3-6,10,16-19,21H,8-9,11-12H2,1-2H3/p+2/t16-,17-,18+,19+/m0/s1 |
| InChIKey | ASVVALHHQXEQAN-INDMIFKZSA-P |
| XLogP | -1.73 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |