C22H20N6O5 — CID 74687733
3-[[[6-[5-(1,3-benzodioxol-5-yloxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]methyl]benzonitrile (PubChem CID 74687733) has the molecular formula C22H20N6O5 and a molecular weight of 448.44 g/mol. Its IUPAC name is 3-[[[6-[5-(1,3-benzodioxol-5-yloxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[6-[5-(1,3-benzodioxol-5-yloxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 74687733 |
| Molecular Formula | C22H20N6O5 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-[[[6-[5-(1,3-benzodioxol-5-yloxy)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNC2COC3C2OCC3n2nnnc2Oc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H20N6O5/c23-8-13-2-1-3-14(6-13)9-24-16-10-29-21-17(11-30-20(16)21)28-22(25-26-27-28)33-15-4-5-18-19(7-15)32-12-31-18/h1-7,16-17,20-21,24H,9-12H2 |
| InChIKey | GCNJNGVFFRLOQI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |