C18H20N5O4+ — CID 11913284
[(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(3-cyanophenyl)methyl]azanium (PubChem CID 11913284) has the molecular formula C18H20N5O4+ and a molecular weight of 370.39 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(3-cyanophenyl)methyl]azanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(3-cyanophenyl)methyl]azanium |
|---|---|
| PubChem CID | 11913284 |
| Molecular Formula | C18H20N5O4+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-(4-methoxycarbonyltriazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-[(3-cyanophenyl)methyl]azanium |
| SMILES | COC(=O)c1cn([C@H]2CO[C@H]3[C@@H]2OC[C@@H]3[NH2+]Cc2cccc(C#N)c2)nn1 |
| InChI | InChI=1S/C18H19N5O4/c1-25-18(24)13-8-23(22-21-13)15-10-27-16-14(9-26-17(15)16)20-7-12-4-2-3-11(5-12)6-19/h2-5,8,14-17,20H,7,9-10H2,1H3/p+1/t14-,15-,16+,17+/m0/s1 |
| InChIKey | ATOIBUNZWPNKJJ-MWDXBVQZSA-O |
| XLogP | -0.59 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |