C23H22N4O7 — CID 11886665
methyl 1-[(3S,3aR,6R,6aS)-6-[(4-phenoxyphenyl)carbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]triazole-4-carboxylate (PubChem CID 11886665) has the molecular formula C23H22N4O7 and a molecular weight of 466.45 g/mol. Its IUPAC name is methyl 1-[(3S,3aR,6R,6aS)-6-[(4-phenoxyphenyl)carbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3S,3aR,6R,6aS)-6-[(4-phenoxyphenyl)carbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 11886665 |
| Molecular Formula | C23H22N4O7 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | methyl 1-[(3S,3aR,6R,6aS)-6-[(4-phenoxyphenyl)carbamoyloxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@H]2CO[C@H]3[C@@H]2OC[C@H]3OC(=O)Nc2ccc(Oc3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C23H22N4O7/c1-30-22(28)17-11-27(26-25-17)18-12-31-21-19(13-32-20(18)21)34-23(29)24-14-7-9-16(10-8-14)33-15-5-3-2-4-6-15/h2-11,18-21H,12-13H2,1H3,(H,24,29)/t18-,19+,20+,21+/m0/s1 |
| InChIKey | TUIMLOZGSLVESN-DOIPELPJSA-N |
| XLogP | 2.81 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |