C25H25N3O7 — CID 73134197
[3-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate (PubChem CID 73134197) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate.
| Compound Name | [3-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
|---|---|
| PubChem CID | 73134197 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [3-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
| SMILES | Cc1noc(C)c1C(=O)NC1COC2C(OC(=O)Nc3ccc(Oc4ccccc4)cc3)COC12 |
| InChI | InChI=1S/C25H25N3O7/c1-14-21(15(2)35-28-14)24(29)27-19-12-31-23-20(13-32-22(19)23)34-25(30)26-16-8-10-18(11-9-16)33-17-6-4-3-5-7-17/h3-11,19-20,22-23H,12-13H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | VTEMNRFURHDZNH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |