C26H26N2O7S — CID 73133184
[3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate (PubChem CID 73133184) has the molecular formula C26H26N2O7S and a molecular weight of 510.57 g/mol. Its IUPAC name is [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate.
| Compound Name | [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
|---|---|
| PubChem CID | 73133184 |
| Molecular Formula | C26H26N2O7S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-phenoxyphenyl)carbamate |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)OC1COC2C(NS(=O)(=O)Cc3ccccc3)COC12 |
| InChI | InChI=1S/C26H26N2O7S/c29-26(27-19-11-13-21(14-12-19)34-20-9-5-2-6-10-20)35-23-16-33-24-22(15-32-25(23)24)28-36(30,31)17-18-7-3-1-4-8-18/h1-14,22-25,28H,15-17H2,(H,27,29) |
| InChIKey | WHWLBRMELBADLH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |