C21H21F3N2O6S — CID 163177406
[(3R,3aR,6R,6aR)-3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 163177406) has the molecular formula C21H21F3N2O6S and a molecular weight of 486.47 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 163177406 |
| Molecular Formula | C21H21F3N2O6S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)O[C@@H]1CO[C@H]2[C@H]1OC[C@H]2NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H21F3N2O6S/c22-21(23,24)14-7-4-8-15(9-14)25-20(27)32-17-11-31-18-16(10-30-19(17)18)26-33(28,29)12-13-5-2-1-3-6-13/h1-9,16-19,26H,10-12H2,(H,25,27)/t16-,17-,18-,19+/m1/s1 |
| InChIKey | XUTBDRAMEBIAOF-MKXGPGLRSA-N |
| XLogP | 2.91 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |