C17H19F3N2O6 — CID 11883391
[(3S,3aR,6R,6aS)-3-[(2-methoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 11883391) has the molecular formula C17H19F3N2O6 and a molecular weight of 404.34 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[(2-methoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[(2-methoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 11883391 |
| Molecular Formula | C17H19F3N2O6 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[(2-methoxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | COCC(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19F3N2O6/c1-25-8-13(23)22-11-6-26-15-12(7-27-14(11)15)28-16(24)21-10-4-2-3-9(5-10)17(18,19)20/h2-5,11-12,14-15H,6-8H2,1H3,(H,21,24)(H,22,23)/t11-,12+,14+,15+/m0/s1 |
| InChIKey | TXOWTTLLFICIKJ-CTHBEMJXSA-N |
| XLogP | 1.55 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |