C22H29N3O6 — CID 74699955
[3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate (PubChem CID 74699955) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is [3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate.
| Compound Name | [3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 74699955 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [3-(cyclohexylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(3-acetylphenyl)carbamate |
| SMILES | CC(=O)c1cccc(NC(=O)OC2COC3C(NC(=O)NC4CCCCC4)COC23)c1 |
| InChI | InChI=1S/C22H29N3O6/c1-13(26)14-6-5-9-16(10-14)24-22(28)31-18-12-30-19-17(11-29-20(18)19)25-21(27)23-15-7-3-2-4-8-15/h5-6,9-10,15,17-20H,2-4,7-8,11-12H2,1H3,(H,24,28)(H2,23,25,27) |
| InChIKey | BNCKDQKMWTWMKT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |