C24H25N3O7 — CID 163167399
[(3R,3aR,6R,6aR)-3-[(4-acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate (PubChem CID 163167399) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-[(4-acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(3R,3aR,6R,6aR)-3-[(4-acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 163167399 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-[(4-acetylphenyl)carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)N[C@@H]2CO[C@@H]3[C@@H]2OC[C@H]3OC(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O7/c1-13(28)15-3-7-17(8-4-15)25-23(30)27-19-11-32-22-20(12-33-21(19)22)34-24(31)26-18-9-5-16(6-10-18)14(2)29/h3-10,19-22H,11-12H2,1-2H3,(H,26,31)(H2,25,27,30)/t19-,20-,21-,22+/m1/s1 |
| InChIKey | TZNOIXXTILSVSK-YSFYHYPLSA-N |
| XLogP | 3.00 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |