C22H24N2O7S — CID 73133301
[3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate (PubChem CID 73133301) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 73133301 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [3-(benzylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)OC2COC3C(NS(=O)(=O)Cc4ccccc4)COC23)cc1 |
| InChI | InChI=1S/C22H24N2O7S/c1-14(25)16-7-9-17(10-8-16)23-22(26)31-19-12-30-20-18(11-29-21(19)20)24-32(27,28)13-15-5-3-2-4-6-15/h2-10,18-21,24H,11-13H2,1H3,(H,23,26) |
| InChIKey | NMANOVXEQYYRDE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |