C19H20N2O7S2 — CID 162895152
[(3S,3aS,6S,6aS)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate (PubChem CID 162895152) has the molecular formula C19H20N2O7S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is [(3S,3aS,6S,6aS)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(3S,3aS,6S,6aS)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 162895152 |
| Molecular Formula | C19H20N2O7S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [(3S,3aS,6S,6aS)-3-(thiophen-2-ylsulfonylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@H]2CO[C@@H]3[C@@H]2OC[C@@H]3NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H20N2O7S2/c1-11(22)12-4-6-13(7-5-12)20-19(23)28-15-10-27-17-14(9-26-18(15)17)21-30(24,25)16-3-2-8-29-16/h2-8,14-15,17-18,21H,9-10H2,1H3,(H,20,23)/t14-,15-,17-,18+/m0/s1 |
| InChIKey | SLZMMRVDTYXKPK-UOVPBQLFSA-N |
| XLogP | 2.01 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |