C22H21N3O7S — CID 73133299
[3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate (PubChem CID 73133299) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is [3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 73133299 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [3-[(2-cyanophenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)OC2COC3C(NS(=O)(=O)c4ccccc4C#N)COC23)cc1 |
| InChI | InChI=1S/C22H21N3O7S/c1-13(26)14-6-8-16(9-7-14)24-22(27)32-18-12-31-20-17(11-30-21(18)20)25-33(28,29)19-5-3-2-4-15(19)10-23/h2-9,17-18,20-21,25H,11-12H2,1H3,(H,24,27) |
| InChIKey | WFSLLUBNERJFRU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |