C22H26N2O9S — CID 11884073
[(3S,3aR,6R,6aS)-3-[(2,5-dimethoxyphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate (PubChem CID 11884073) has the molecular formula C22H26N2O9S and a molecular weight of 494.52 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-[(2,5-dimethoxyphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(3S,3aR,6R,6aS)-3-[(2,5-dimethoxyphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11884073 |
| Molecular Formula | C22H26N2O9S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-[(2,5-dimethoxyphenyl)sulfonylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)O[C@@H]2CO[C@H]3[C@@H]2OC[C@@H]3NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H26N2O9S/c1-28-14-6-4-13(5-7-14)23-22(25)33-18-12-32-20-16(11-31-21(18)20)24-34(26,27)19-10-15(29-2)8-9-17(19)30-3/h4-10,16,18,20-21,24H,11-12H2,1-3H3,(H,23,25)/t16-,18+,20+,21+/m0/s1 |
| InChIKey | FXBGJALMNCBSLM-RCVZYCBYSA-N |
| XLogP | 1.77 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |