C21H25NO7S — CID 11886502
N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 11886502) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 11886502 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(3S,3aR,6R,6aS)-6-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H25NO7S/c1-25-15-8-9-17(26-2)19(10-15)30(23,24)22-16-12-28-21-18(13-29-20(16)21)27-11-14-6-4-3-5-7-14/h3-10,16,18,20-22H,11-13H2,1-2H3/t16-,18+,20+,21+/m0/s1 |
| InChIKey | ZNMQUXGCJQVFGH-RCVZYCBYSA-N |
| XLogP | 1.73 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |