C17H19NO6S — CID 9115180
(2S)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 9115180) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 9115180 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2S)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H19NO6S/c1-23-13-8-9-15(24-2)16(11-13)25(21,22)18-14(17(19)20)10-12-6-4-3-5-7-12/h3-9,11,14,18H,10H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | RAFXOZPWWMVBIR-AWEZNQCLSA-N |
| XLogP | 1.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |