C17H18NO6S- — CID 9115181
(2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 9115181) has the molecular formula C17H18NO6S- and a molecular weight of 364.40 g/mol. Its IUPAC name is (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 9115181 |
| Molecular Formula | C17H18NO6S- |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C17H19NO6S/c1-23-13-8-9-15(24-2)16(11-13)25(21,22)18-14(17(19)20)10-12-6-4-3-5-7-12/h3-9,11,14,18H,10H2,1-2H3,(H,19,20)/p-1/t14-/m1/s1 |
| InChIKey | RAFXOZPWWMVBIR-CQSZACIVSA-M |
| XLogP | 0.34 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |