C16H17NO6S — CID 86776629
2-[(2,5-dimethoxyphenyl)sulfonylamino]-2-phenylacetic acid (PubChem CID 86776629) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-2-phenylacetic acid.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 86776629 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-2-phenylacetic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(C(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H17NO6S/c1-22-12-8-9-13(23-2)14(10-12)24(20,21)17-15(16(18)19)11-6-4-3-5-7-11/h3-10,15,17H,1-2H3,(H,18,19) |
| InChIKey | HOZZFMLZRMIDHC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |