C14H21NO8S2 — CID 108781283
2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-ethylsulfonylbutanoic acid (PubChem CID 108781283) has the molecular formula C14H21NO8S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108781283 |
| Molecular Formula | C14H21NO8S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NS(=O)(=O)c1cc(OC)ccc1OC)C(=O)O |
| InChI | InChI=1S/C14H21NO8S2/c1-4-24(18,19)8-7-11(14(16)17)15-25(20,21)13-9-10(22-2)5-6-12(13)23-3/h5-6,9,11,15H,4,7-8H2,1-3H3,(H,16,17) |
| InChIKey | ZHSVWCQMOSXMNX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |