C13H18N2O7S — CID 9403870
(2S)-5-amino-2-[(2,5-dimethoxyphenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 9403870) has the molecular formula C13H18N2O7S and a molecular weight of 346.36 g/mol. Its IUPAC name is (2S)-5-amino-2-[(2,5-dimethoxyphenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(2,5-dimethoxyphenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 9403870 |
| Molecular Formula | C13H18N2O7S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (2S)-5-amino-2-[(2,5-dimethoxyphenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N[C@@H](CCC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C13H18N2O7S/c1-21-8-3-5-10(22-2)11(7-8)23(19,20)15-9(13(17)18)4-6-12(14)16/h3,5,7,9,15H,4,6H2,1-2H3,(H2,14,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | JFWJJKWXZAHSCT-VIFPVBQESA-N |
| XLogP | -0.30 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |