C20H25NO6S2 — CID 5010520
ethyl 3-benzylsulfanyl-2-[(2,5-dimethoxyphenyl)sulfonylamino]propanoate (PubChem CID 5010520) has the molecular formula C20H25NO6S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 3-benzylsulfanyl-2-[(2,5-dimethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-benzylsulfanyl-2-[(2,5-dimethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 5010520 |
| Molecular Formula | C20H25NO6S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | ethyl 3-benzylsulfanyl-2-[(2,5-dimethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(CSCc1ccccc1)NS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H25NO6S2/c1-4-27-20(22)17(14-28-13-15-8-6-5-7-9-15)21-29(23,24)19-12-16(25-2)10-11-18(19)26-3/h5-12,17,21H,4,13-14H2,1-3H3 |
| InChIKey | WPTJUOKFJSGLNS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |