C23H32N2O8S2 — CID 3870360
ethyl 2-[(2,5-dimethoxyphenyl)sulfonylamino]-6-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3870360) has the molecular formula C23H32N2O8S2 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethoxyphenyl)sulfonylamino]-6-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | ethyl 2-[(2,5-dimethoxyphenyl)sulfonylamino]-6-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3870360 |
| Molecular Formula | C23H32N2O8S2 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethyl 2-[(2,5-dimethoxyphenyl)sulfonylamino]-6-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCOC(=O)C(CCCCNS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H32N2O8S2/c1-5-33-23(26)20(25-35(29,30)22-16-18(31-3)11-14-21(22)32-4)8-6-7-15-24-34(27,28)19-12-9-17(2)10-13-19/h9-14,16,20,24-25H,5-8,15H2,1-4H3 |
| InChIKey | FJNBJDLTHZTTNR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|