C22H28N2O6S — CID 172880304
ethyl 2-deuterio-2-[(4-methoxybenzoyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 172880304) has the molecular formula C22H28N2O6S and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 2-deuterio-2-[(4-methoxybenzoyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | ethyl 2-deuterio-2-[(4-methoxybenzoyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 172880304 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | ethyl 2-deuterio-2-[(4-methoxybenzoyl)amino]-5-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | [2H]C(CCCNS(=O)(=O)c1ccc(C)cc1)(NC(=O)c1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C22H28N2O6S/c1-4-30-22(26)20(24-21(25)17-9-11-18(29-3)12-10-17)6-5-15-23-31(27,28)19-13-7-16(2)8-14-19/h7-14,20,23H,4-6,15H2,1-3H3,(H,24,25)/i20D |
| InChIKey | KZGMUVWHSGGTSR-YVHRXSIGSA-N |
| XLogP | 2.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|