C15H14FNO5S — CID 42184451
(2S)-2-[(3-fluoro-4-methoxyphenyl)sulfonylamino]-2-phenylacetic acid (PubChem CID 42184451) has the molecular formula C15H14FNO5S and a molecular weight of 339.34 g/mol. Its IUPAC name is (2S)-2-[(3-fluoro-4-methoxyphenyl)sulfonylamino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(3-fluoro-4-methoxyphenyl)sulfonylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 42184451 |
| Molecular Formula | C15H14FNO5S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (2S)-2-[(3-fluoro-4-methoxyphenyl)sulfonylamino]-2-phenylacetic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)O)c2ccccc2)cc1F |
| InChI | InChI=1S/C15H14FNO5S/c1-22-13-8-7-11(9-12(13)16)23(20,21)17-14(15(18)19)10-5-3-2-4-6-10/h2-9,14,17H,1H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | OMJZZPXZVHRBKD-AWEZNQCLSA-N |
| XLogP | 1.94 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |