C12H14F3NO5S — CID 120606796
(2R)-2-[[4-(difluoromethoxy)-3-fluorophenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 120606796) has the molecular formula C12H14F3NO5S and a molecular weight of 341.31 g/mol. Its IUPAC name is (2R)-2-[[4-(difluoromethoxy)-3-fluorophenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-(difluoromethoxy)-3-fluorophenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 120606796 |
| Molecular Formula | C12H14F3NO5S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (2R)-2-[[4-(difluoromethoxy)-3-fluorophenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc(OC(F)F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F3NO5S/c1-6(2)10(11(17)18)16-22(19,20)7-3-4-9(8(13)5-7)21-12(14)15/h3-6,10,12,16H,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | OQKFZWMJRODTJC-SNVBAGLBSA-N |
| XLogP | 1.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |