C13H19F3N2O3S — CID 120875444
N-(2-amino-2-ethylbutyl)-4-(difluoromethoxy)-3-fluorobenzenesulfonamide (PubChem CID 120875444) has the molecular formula C13H19F3N2O3S and a molecular weight of 340.37 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-(difluoromethoxy)-3-fluorobenzenesulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-(difluoromethoxy)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 120875444 |
| Molecular Formula | C13H19F3N2O3S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-(difluoromethoxy)-3-fluorobenzenesulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C13H19F3N2O3S/c1-3-13(17,4-2)8-18-22(19,20)9-5-6-11(10(14)7-9)21-12(15)16/h5-7,12,18H,3-4,8,17H2,1-2H3 |
| InChIKey | URZUEWIVIKAAEV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |