C18H22FNO4S — CID 71810764
3-fluoro-4-methoxy-N-(2-methoxy-2-phenylbutyl)benzenesulfonamide (PubChem CID 71810764) has the molecular formula C18H22FNO4S and a molecular weight of 367.44 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-(2-methoxy-2-phenylbutyl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-(2-methoxy-2-phenylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71810764 |
| Molecular Formula | C18H22FNO4S |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-fluoro-4-methoxy-N-(2-methoxy-2-phenylbutyl)benzenesulfonamide |
| SMILES | CCC(CNS(=O)(=O)c1ccc(OC)c(F)c1)(OC)c1ccccc1 |
| InChI | InChI=1S/C18H22FNO4S/c1-4-18(24-3,14-8-6-5-7-9-14)13-20-25(21,22)15-10-11-17(23-2)16(19)12-15/h5-12,20H,4,13H2,1-3H3 |
| InChIKey | JROVEPIHRYTCPG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |