methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate

C15H24N2O5S — CID 119989908

IUPACmethyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate
SMILESCCC(N)(CC)CNS(=O)(=O)c1ccc(OC)c(C(=O)OC)c1
InChIInChI=1S/C15H24N2O5S/c1-5-15(16,6-2)10-17-23(19,20)11-7-8-13(21-3)12(9-11)14(18)22-4/h7-9,17H,5-6,10,16H2,1-4H3
InChIKeyBEWUIHXXXSIIJF-UHFFFAOYSA-N
MW344.43 g/mol
LogP1.28
Rot. Bonds8

About methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate

methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate (PubChem CID 119989908) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate.

Molecular Properties

Compound Namemethyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate
PubChem CID119989908
Molecular FormulaC15H24N2O5S
Molecular Weight344.43 g/mol
Exact Mass344.14
IUPAC Namemethyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate
SMILESCCC(N)(CC)CNS(=O)(=O)c1ccc(OC)c(C(=O)OC)c1
InChIInChI=1S/C15H24N2O5S/c1-5-15(16,6-2)10-17-23(19,20)11-7-8-13(21-3)12(9-11)14(18)22-4/h7-9,17H,5-6,10,16H2,1-4H3
InChIKeyBEWUIHXXXSIIJF-UHFFFAOYSA-N
XLogP1.28
TPSA107.72 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500344.43
LogP ≤ 51.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate?
The IUPAC name of methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate (CID 119989908) is methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate.
What is the SMILES notation for methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate?
The canonical SMILES for methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate is CCC(N)(CC)CNS(=O)(=O)c1ccc(OC)c(C(=O)OC)c1.
What is the InChIKey of methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate?
The InChIKey is BEWUIHXXXSIIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O5S/c1-5-15(16,6-2)10-17-23(19,20)11-7-8-13(21-3)12(9-11)14(18)22-4/h7-9,17H,5-6,10,16H2,1-4H3.
What are the key properties of methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate?
methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate has a molecular weight of 344.43 g/mol, XLogP of 1.28, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2-amino-2-ethylbutyl)sulfamoyl]-2-methoxybenzoate is sourced from PubChem (CID 119989908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).